C30H31F3N6O3 — CID 157023084
4-[(heptanoylamino)methyl]-N-[5-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide (PubChem CID 157023084) has the molecular formula C30H31F3N6O3 and a molecular weight of 580.61 g/mol. Its IUPAC name is 4-[(heptanoylamino)methyl]-N-[5-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide.
| Compound Name | 4-[(heptanoylamino)methyl]-N-[5-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide |
|---|---|
| PubChem CID | 157023084 |
| Molecular Formula | C30H31F3N6O3 |
| Molecular Weight | 580.61 g/mol |
| Exact Mass | 580.24 |
| IUPAC Name | 4-[(heptanoylamino)methyl]-N-[5-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]benzamide |
| SMILES | CCCCCCC(=O)NCc1ccc(C(=O)Nc2nc(-c3ncccc3C)nn2-c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C30H31F3N6O3/c1-3-4-5-6-9-25(40)35-19-21-10-12-22(13-11-21)28(41)37-29-36-27(26-20(2)8-7-18-34-26)38-39(29)23-14-16-24(17-15-23)42-30(31,32)33/h7-8,10-18H,3-6,9,19H2,1-2H3,(H,35,40)(H,36,37,38,41) |
| InChIKey | CZFZGCNWPIKSJF-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.61 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|