C31H32F3N5O3 — CID 158482336
N-[5-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-4-(3-oxononyl)benzamide (PubChem CID 158482336) has the molecular formula C31H32F3N5O3 and a molecular weight of 579.62 g/mol. Its IUPAC name is N-[5-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-4-(3-oxononyl)benzamide.
| Compound Name | N-[5-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-4-(3-oxononyl)benzamide |
|---|---|
| PubChem CID | 158482336 |
| Molecular Formula | C31H32F3N5O3 |
| Molecular Weight | 579.62 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | N-[5-(3-methyl-2-pyridinyl)-2-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]-4-(3-oxononyl)benzamide |
| SMILES | CCCCCCC(=O)CCc1ccc(C(=O)Nc2nc(-c3ncccc3C)nn2-c2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C31H32F3N5O3/c1-3-4-5-6-9-25(40)17-12-22-10-13-23(14-11-22)29(41)37-30-36-28(27-21(2)8-7-20-35-27)38-39(30)24-15-18-26(19-16-24)42-31(32,33)34/h7-8,10-11,13-16,18-20H,3-6,9,12,17H2,1-2H3,(H,36,37,38,41) |
| InChIKey | VNLQBVPUJSPPSP-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.62 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|