C24H17N8O2+ — CID 153496956
[3-[[5-[(3-ethynylbenzoyl)amino]-1-phenyl-1,2,4-triazol-3-yl]carbamoyl]phenyl]imino-iminoazanium (PubChem CID 153496956) has the molecular formula C24H17N8O2+ and a molecular weight of 449.45 g/mol. Its IUPAC name is [3-[[5-[(3-ethynylbenzoyl)amino]-1-phenyl-1,2,4-triazol-3-yl]carbamoyl]phenyl]imino-iminoazanium.
| Compound Name | [3-[[5-[(3-ethynylbenzoyl)amino]-1-phenyl-1,2,4-triazol-3-yl]carbamoyl]phenyl]imino-iminoazanium |
|---|---|
| PubChem CID | 153496956 |
| Molecular Formula | C24H17N8O2+ |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | [3-[[5-[(3-ethynylbenzoyl)amino]-1-phenyl-1,2,4-triazol-3-yl]carbamoyl]phenyl]imino-iminoazanium |
| SMILES | C#Cc1cccc(C(=O)Nc2nc(NC(=O)c3cccc(N=[N+]=N)c3)nn2-c2ccccc2)c1 |
| InChI | InChI=1S/C24H16N8O2/c1-2-16-8-6-9-17(14-16)22(34)27-24-28-23(30-32(24)20-12-4-3-5-13-20)26-21(33)18-10-7-11-19(15-18)29-31-25/h1,3-15,25H,(H-,26,27,28,30,33,34)/p+1 |
| InChIKey | ACKRSRKHYJWNLO-UHFFFAOYSA-O |
| XLogP | 3.94 |
| TPSA | 139.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|