C27H21N7O2 — CID 18184881
N'-[4-[(1,5-diphenyl-1,2,4-triazol-3-yl)amino]benzoyl]pyridine-4-carbohydrazide (PubChem CID 18184881) has the molecular formula C27H21N7O2 and a molecular weight of 475.51 g/mol. Its IUPAC name is N'-[4-[(1,5-diphenyl-1,2,4-triazol-3-yl)amino]benzoyl]pyridine-4-carbohydrazide.
| Compound Name | N'-[4-[(1,5-diphenyl-1,2,4-triazol-3-yl)amino]benzoyl]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 18184881 |
| Molecular Formula | C27H21N7O2 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | N'-[4-[(1,5-diphenyl-1,2,4-triazol-3-yl)amino]benzoyl]pyridine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc(Nc2nc(-c3ccccc3)n(-c3ccccc3)n2)cc1)c1ccncc1 |
| InChI | InChI=1S/C27H21N7O2/c35-25(31-32-26(36)21-15-17-28-18-16-21)20-11-13-22(14-12-20)29-27-30-24(19-7-3-1-4-8-19)34(33-27)23-9-5-2-6-10-23/h1-18H,(H,29,33)(H,31,35)(H,32,36) |
| InChIKey | JQDFYZDIQKGVMB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|