C32H24N6O2 — CID 18184865
N'-[4-[(1,5-diphenyl-1,2,4-triazol-3-yl)amino]benzoyl]naphthalene-2-carbohydrazide (PubChem CID 18184865) has the molecular formula C32H24N6O2 and a molecular weight of 524.58 g/mol. Its IUPAC name is N'-[4-[(1,5-diphenyl-1,2,4-triazol-3-yl)amino]benzoyl]naphthalene-2-carbohydrazide.
| Compound Name | N'-[4-[(1,5-diphenyl-1,2,4-triazol-3-yl)amino]benzoyl]naphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 18184865 |
| Molecular Formula | C32H24N6O2 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | N'-[4-[(1,5-diphenyl-1,2,4-triazol-3-yl)amino]benzoyl]naphthalene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc2ccccc2c1)c1ccc(Nc2nc(-c3ccccc3)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C32H24N6O2/c39-30(35-36-31(40)26-16-15-22-9-7-8-12-25(22)21-26)24-17-19-27(20-18-24)33-32-34-29(23-10-3-1-4-11-23)38(37-32)28-13-5-2-6-14-28/h1-21H,(H,33,37)(H,35,39)(H,36,40) |
| InChIKey | VRHFTSCXYCWFNE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|