C28H21F3N6O3S — CID 18184877
N'-(benzenesulfonyl)-4-[[5-phenyl-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]amino]benzohydrazide (PubChem CID 18184877) has the molecular formula C28H21F3N6O3S and a molecular weight of 578.58 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-4-[[5-phenyl-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]amino]benzohydrazide.
| Compound Name | N'-(benzenesulfonyl)-4-[[5-phenyl-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]amino]benzohydrazide |
|---|---|
| PubChem CID | 18184877 |
| Molecular Formula | C28H21F3N6O3S |
| Molecular Weight | 578.58 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | N'-(benzenesulfonyl)-4-[[5-phenyl-1-[4-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]amino]benzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccccc1)c1ccc(Nc2nc(-c3ccccc3)n(-c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C28H21F3N6O3S/c29-28(30,31)21-13-17-23(18-14-21)37-25(19-7-3-1-4-8-19)33-27(35-37)32-22-15-11-20(12-16-22)26(38)34-36-41(39,40)24-9-5-2-6-10-24/h1-18,36H,(H,32,35)(H,34,38) |
| InChIKey | FXOBAYLVBMAQLY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|