C28H20ClF3N6O3S — CID 18184850
N'-(benzenesulfonyl)-4-[[5-(2-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]amino]benzohydrazide (PubChem CID 18184850) has the molecular formula C28H20ClF3N6O3S and a molecular weight of 613.02 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-4-[[5-(2-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]amino]benzohydrazide.
| Compound Name | N'-(benzenesulfonyl)-4-[[5-(2-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]amino]benzohydrazide |
|---|---|
| PubChem CID | 18184850 |
| Molecular Formula | C28H20ClF3N6O3S |
| Molecular Weight | 613.02 g/mol |
| Exact Mass | 612.10 |
| IUPAC Name | N'-(benzenesulfonyl)-4-[[5-(2-chlorophenyl)-1-[3-(trifluoromethyl)phenyl]-1,2,4-triazol-3-yl]amino]benzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccccc1)c1ccc(Nc2nc(-c3ccccc3Cl)n(-c3cccc(C(F)(F)F)c3)n2)cc1 |
| InChI | InChI=1S/C28H20ClF3N6O3S/c29-24-12-5-4-11-23(24)25-34-27(36-38(25)21-8-6-7-19(17-21)28(30,31)32)33-20-15-13-18(14-16-20)26(39)35-37-42(40,41)22-9-2-1-3-10-22/h1-17,37H,(H,33,36)(H,35,39) |
| InChIKey | DWJRGBBGRKKMMB-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.02 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|