C19H13ClF3N3O2 — CID 27824744
N-(2-chlorophenyl)-6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide (PubChem CID 27824744) has the molecular formula C19H13ClF3N3O2 and a molecular weight of 407.78 g/mol. Its IUPAC name is N-(2-chlorophenyl)-6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide.
| Compound Name | N-(2-chlorophenyl)-6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 27824744 |
| Molecular Formula | C19H13ClF3N3O2 |
| Molecular Weight | 407.78 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | N-(2-chlorophenyl)-6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2ccccc2Cl)nn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H13ClF3N3O2/c1-11-9-16(27)17(18(28)24-15-8-3-2-7-14(15)20)25-26(11)13-6-4-5-12(10-13)19(21,22)23/h2-10H,1H3,(H,24,28) |
| InChIKey | NCJRZFZAYRGVRU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.78 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |