C19H13ClF3N3O3 — CID 55436427
N-(5-chloro-2-hydroxyphenyl)-6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide (PubChem CID 55436427) has the molecular formula C19H13ClF3N3O3 and a molecular weight of 423.78 g/mol. Its IUPAC name is N-(5-chloro-2-hydroxyphenyl)-6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide.
| Compound Name | N-(5-chloro-2-hydroxyphenyl)-6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 55436427 |
| Molecular Formula | C19H13ClF3N3O3 |
| Molecular Weight | 423.78 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | N-(5-chloro-2-hydroxyphenyl)-6-methyl-4-oxo-1-[3-(trifluoromethyl)phenyl]pyridazine-3-carboxamide |
| SMILES | Cc1cc(=O)c(C(=O)Nc2cc(Cl)ccc2O)nn1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H13ClF3N3O3/c1-10-7-16(28)17(18(29)24-14-9-12(20)5-6-15(14)27)25-26(10)13-4-2-3-11(8-13)19(21,22)23/h2-9,27H,1H3,(H,24,29) |
| InChIKey | UQWKCVKMAXMPCO-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.78 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|