C16H15F3N3O3S- — CID 90829017
5-methyl-2,4-diphenyl-3H-1,2,4-triazole;trifluoromethanesulfonate (PubChem CID 90829017) has the molecular formula C16H15F3N3O3S- and a molecular weight of 386.38 g/mol. Its IUPAC name is 5-methyl-2,4-diphenyl-3H-1,2,4-triazole;trifluoromethanesulfonate.
| Compound Name | 5-methyl-2,4-diphenyl-3H-1,2,4-triazole;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90829017 |
| Molecular Formula | C16H15F3N3O3S- |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 5-methyl-2,4-diphenyl-3H-1,2,4-triazole;trifluoromethanesulfonate |
| SMILES | CC1=NN(c2ccccc2)CN1c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C15H15N3.CHF3O3S/c1-13-16-18(15-10-6-3-7-11-15)12-17(13)14-8-4-2-5-9-14;2-1(3,4)8(5,6)7/h2-11H,12H2,1H3;(H,5,6,7)/p-1 |
| InChIKey | YDFHFNCSXJDUOK-UHFFFAOYSA-M |
| XLogP | 3.36 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|