C24H23F3NO5PS — CID 139098711
trifluoromethanesulfonate;(1R,2R,6S,7S)-8,9,10-trimethyl-4,10-diphenyl-4-aza-10-phosphoniatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 139098711) has the molecular formula C24H23F3NO5PS and a molecular weight of 525.49 g/mol. Its IUPAC name is trifluoromethanesulfonate;(1R,2R,6S,7S)-8,9,10-trimethyl-4,10-diphenyl-4-aza-10-phosphoniatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | trifluoromethanesulfonate;(1R,2R,6S,7S)-8,9,10-trimethyl-4,10-diphenyl-4-aza-10-phosphoniatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 139098711 |
| Molecular Formula | C24H23F3NO5PS |
| Molecular Weight | 525.49 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | trifluoromethanesulfonate;(1R,2R,6S,7S)-8,9,10-trimethyl-4,10-diphenyl-4-aza-10-phosphoniatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CC1=C(C)[C@H]2[C@H]3C(=O)N(c4ccccc4)C(=O)[C@H]3[C@@H]1[P+]2(C)c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C23H23NO2P.CHF3O3S/c1-14-15(2)21-19-18(20(14)27(21,3)17-12-8-5-9-13-17)22(25)24(23(19)26)16-10-6-4-7-11-16;2-1(3,4)8(5,6)7/h4-13,18-21H,1-3H3;(H,5,6,7)/q+1;/p-1/t18-,19+,20-,21+,27?; |
| InChIKey | BQGZIKFMDXADPL-GODJGDHDSA-M |
| XLogP | 3.92 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|