C26H22N2O4S — CID 139049719
(1R,8S,9R,13S)-1-methyl-14-(4-methylphenyl)sulfonyl-11-phenyl-11,14-diazatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione (PubChem CID 139049719) has the molecular formula C26H22N2O4S and a molecular weight of 458.54 g/mol. Its IUPAC name is (1R,8S,9R,13S)-1-methyl-14-(4-methylphenyl)sulfonyl-11-phenyl-11,14-diazatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione.
| Compound Name | (1R,8S,9R,13S)-1-methyl-14-(4-methylphenyl)sulfonyl-11-phenyl-11,14-diazatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
|---|---|
| PubChem CID | 139049719 |
| Molecular Formula | C26H22N2O4S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | (1R,8S,9R,13S)-1-methyl-14-(4-methylphenyl)sulfonyl-11-phenyl-11,14-diazatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6-triene-10,12-dione |
| SMILES | Cc1ccc(S(=O)(=O)N2[C@@H]3c4ccccc4[C@@]2(C)[C@H]2C(=O)N(c4ccccc4)C(=O)[C@@H]32)cc1 |
| InChI | InChI=1S/C26H22N2O4S/c1-16-12-14-18(15-13-16)33(31,32)28-23-19-10-6-7-11-20(19)26(28,2)22-21(23)24(29)27(25(22)30)17-8-4-3-5-9-17/h3-15,21-23H,1-2H3/t21-,22-,23-,26+/m1/s1 |
| InChIKey | IZYMYTQKNHGICO-FCBCXNLDSA-N |
| XLogP | 3.78 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|