C32H25N3O2 — CID 126183355
(15R,19R)-17-(4-methylphenyl)-1-[(Z)-(phenylhydrazinylidene)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 126183355) has the molecular formula C32H25N3O2 and a molecular weight of 483.57 g/mol. Its IUPAC name is (15R,19R)-17-(4-methylphenyl)-1-[(Z)-(phenylhydrazinylidene)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19R)-17-(4-methylphenyl)-1-[(Z)-(phenylhydrazinylidene)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 126183355 |
| Molecular Formula | C32H25N3O2 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | (15R,19R)-17-(4-methylphenyl)-1-[(Z)-(phenylhydrazinylidene)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3C4c5ccccc5C(/C=N\Nc5ccccc5)(c5ccccc54)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C32H25N3O2/c1-20-15-17-22(18-16-20)35-30(36)28-27-23-11-5-7-13-25(23)32(29(28)31(35)37,26-14-8-6-12-24(26)27)19-33-34-21-9-3-2-4-10-21/h2-19,27-29,34H,1H3/b33-19-/t27?,28-,29+,32?/m1/s1 |
| InChIKey | CKTONNIZHHXOJU-VNZBKBETSA-N |
| XLogP | 5.64 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|