C35H33N3O3 — CID 5041501
1-methyl-N-[[17-(4-methylphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide (PubChem CID 5041501) has the molecular formula C35H33N3O3 and a molecular weight of 543.67 g/mol. Its IUPAC name is 1-methyl-N-[[17-(4-methylphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide.
| Compound Name | 1-methyl-N-[[17-(4-methylphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide |
|---|---|
| PubChem CID | 5041501 |
| Molecular Formula | C35H33N3O3 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 1-methyl-N-[[17-(4-methylphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]bicyclo[4.1.0]heptane-7-carboxamide |
| SMILES | Cc1ccc(N2C(=O)C3C4c5ccccc5C(C=NNC(=O)C5C6CCCCC65C)(c5ccccc54)C3C2=O)cc1 |
| InChI | InChI=1S/C35H33N3O3/c1-20-14-16-21(17-15-20)38-32(40)28-27-22-9-3-5-11-24(22)35(30(28)33(38)41,25-12-6-4-10-23(25)27)19-36-37-31(39)29-26-13-7-8-18-34(26,29)2/h3-6,9-12,14-17,19,26-30H,7-8,13,18H2,1-2H3,(H,37,39) |
| InChIKey | GMHIAELTRWWPKF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|