C31H26FN3O5 — CID 3669867
N-[[17-(4-fluorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide (PubChem CID 3669867) has the molecular formula C31H26FN3O5 and a molecular weight of 539.56 g/mol. Its IUPAC name is N-[[17-(4-fluorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide.
| Compound Name | N-[[17-(4-fluorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 3669867 |
| Molecular Formula | C31H26FN3O5 |
| Molecular Weight | 539.56 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | N-[[17-(4-fluorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
| SMILES | CC1(CC(=O)NN=CC23c4ccccc4C(c4ccccc42)C2C(=O)N(c4ccc(F)cc4)C(=O)C23)OCCO1 |
| InChI | InChI=1S/C31H26FN3O5/c1-30(39-14-15-40-30)16-24(36)34-33-17-31-22-8-4-2-6-20(22)25(21-7-3-5-9-23(21)31)26-27(31)29(38)35(28(26)37)19-12-10-18(32)11-13-19/h2-13,17,25-27H,14-16H2,1H3,(H,34,36) |
| InChIKey | VTOFLBOPQLNSEL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|