C34H26FN3O3 — CID 124558875
N-[(Z)-[(15S,19S)-17-(4-fluorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-phenylpropanamide (PubChem CID 124558875) has the molecular formula C34H26FN3O3 and a molecular weight of 543.60 g/mol. Its IUPAC name is N-[(Z)-[(15S,19S)-17-(4-fluorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-phenylpropanamide.
| Compound Name | N-[(Z)-[(15S,19S)-17-(4-fluorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 124558875 |
| Molecular Formula | C34H26FN3O3 |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | N-[(Z)-[(15S,19S)-17-(4-fluorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)N/N=C\C12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)N(c3ccc(F)cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C34H26FN3O3/c35-22-15-17-23(18-16-22)38-32(40)30-29-24-10-4-6-12-26(24)34(31(30)33(38)41,27-13-7-5-11-25(27)29)20-36-37-28(39)19-14-21-8-2-1-3-9-21/h1-13,15-18,20,29-31H,14,19H2,(H,37,39)/b36-20-/t29?,30-,31+,34?/m0/s1 |
| InChIKey | XTRIWOOMKGYUSX-JXVUSSLYSA-N |
| XLogP | 5.11 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|