C33H24N4O5 — CID 124558754
N-[(Z)-[(15R,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(4-nitrophenyl)acetamide (PubChem CID 124558754) has the molecular formula C33H24N4O5 and a molecular weight of 556.58 g/mol. Its IUPAC name is N-[(Z)-[(15R,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[(Z)-[(15R,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 124558754 |
| Molecular Formula | C33H24N4O5 |
| Molecular Weight | 556.58 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | N-[(Z)-[(15R,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(4-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)N/N=C\C12c3ccccc3C(c3ccccc31)[C@H]1C(=O)N(c3ccccc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C33H24N4O5/c38-27(18-20-14-16-22(17-15-20)37(41)42)35-34-19-33-25-12-6-4-10-23(25)28(24-11-5-7-13-26(24)33)29-30(33)32(40)36(31(29)39)21-8-2-1-3-9-21/h1-17,19,28-30H,18H2,(H,35,38)/b34-19-/t28?,29-,30+,33?/m1/s1 |
| InChIKey | XDQRIMYXIVYHBH-DNHRUJLYSA-N |
| XLogP | 4.49 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.58 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|