C32H23N5O5 — CID 126038746
2-amino-N-[(Z)-[(15S,19R)-17-(4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide (PubChem CID 126038746) has the molecular formula C32H23N5O5 and a molecular weight of 557.57 g/mol. Its IUPAC name is 2-amino-N-[(Z)-[(15S,19R)-17-(4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide.
| Compound Name | 2-amino-N-[(Z)-[(15S,19R)-17-(4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126038746 |
| Molecular Formula | C32H23N5O5 |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 2-amino-N-[(Z)-[(15S,19R)-17-(4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide |
| SMILES | Nc1ccccc1C(=O)N/N=C\C12c3ccccc3C(c3ccccc31)[C@H]1C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C32H23N5O5/c33-25-12-6-3-9-22(25)29(38)35-34-17-32-23-10-4-1-7-20(23)26(21-8-2-5-11-24(21)32)27-28(32)31(40)36(30(27)39)18-13-15-19(16-14-18)37(41)42/h1-17,26-28H,33H2,(H,35,38)/b34-17-/t26?,27-,28-,32?/m1/s1 |
| InChIKey | CNCBVKOKYUABKL-RAAYPUKUSA-N |
| XLogP | 4.14 |
| TPSA | 148.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|