C32H23FN4O3 — CID 124558641
2-amino-N-[(Z)-[(15R,19S)-17-(4-fluorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide (PubChem CID 124558641) has the molecular formula C32H23FN4O3 and a molecular weight of 530.56 g/mol. Its IUPAC name is 2-amino-N-[(Z)-[(15R,19S)-17-(4-fluorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide.
| Compound Name | 2-amino-N-[(Z)-[(15R,19S)-17-(4-fluorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 124558641 |
| Molecular Formula | C32H23FN4O3 |
| Molecular Weight | 530.56 g/mol |
| Exact Mass | 530.18 |
| IUPAC Name | 2-amino-N-[(Z)-[(15R,19S)-17-(4-fluorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide |
| SMILES | Nc1ccccc1C(=O)N/N=C\C12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)N(c3ccc(F)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C32H23FN4O3/c33-18-13-15-19(16-14-18)37-30(39)27-26-20-7-1-4-10-23(20)32(28(27)31(37)40,24-11-5-2-8-21(24)26)17-35-36-29(38)22-9-3-6-12-25(22)34/h1-17,26-28H,34H2,(H,36,38)/b35-17-/t26?,27-,28-,32?/m0/s1 |
| InChIKey | AKRRHPUSCBJDCE-LNFHBKAXSA-N |
| XLogP | 4.37 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|