C32H23N3O4 — CID 41329597
N-[(Z)-[(15S,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-hydroxybenzamide (PubChem CID 41329597) has the molecular formula C32H23N3O4 and a molecular weight of 513.55 g/mol. Its IUPAC name is N-[(Z)-[(15S,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-hydroxybenzamide.
| Compound Name | N-[(Z)-[(15S,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 41329597 |
| Molecular Formula | C32H23N3O4 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | N-[(Z)-[(15S,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-hydroxybenzamide |
| SMILES | O=C(N/N=C\C12c3ccccc3C(c3ccccc31)[C@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12)c1ccccc1O |
| InChI | InChI=1S/C32H23N3O4/c36-25-17-9-6-14-22(25)29(37)34-33-18-32-23-15-7-4-12-20(23)26(21-13-5-8-16-24(21)32)27-28(32)31(39)35(30(27)38)19-10-2-1-3-11-19/h1-18,26-28,36H,(H,34,37)/b33-18-/t26?,27-,28-,32?/m1/s1 |
| InChIKey | WRWZPYSQSQZNPJ-DXQDFUFTSA-N |
| XLogP | 4.36 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|