C33H23N3O5 — CID 98069411
N-[(E)-[(15S,19S)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-1,3-benzodioxole-5-carboxamide (PubChem CID 98069411) has the molecular formula C33H23N3O5 and a molecular weight of 541.56 g/mol. Its IUPAC name is N-[(E)-[(15S,19S)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(E)-[(15S,19S)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 98069411 |
| Molecular Formula | C33H23N3O5 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | N-[(E)-[(15S,19S)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(N/N=C/C12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C33H23N3O5/c37-30(19-14-15-25-26(16-19)41-18-40-25)35-34-17-33-23-12-6-4-10-21(23)27(22-11-5-7-13-24(22)33)28-29(33)32(39)36(31(28)38)20-8-2-1-3-9-20/h1-17,27-29H,18H2,(H,35,37)/b34-17+/t27?,28-,29+,33?/m0/s1 |
| InChIKey | RDNNLCSFJAJZGF-RMJOWRAASA-N |
| XLogP | 4.38 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|