C32H23N3O3 — CID 93478325
N-[(E)-[(15S,19S)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide (PubChem CID 93478325) has the molecular formula C32H23N3O3 and a molecular weight of 497.55 g/mol. Its IUPAC name is N-[(E)-[(15S,19S)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide.
| Compound Name | N-[(E)-[(15S,19S)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 93478325 |
| Molecular Formula | C32H23N3O3 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-[(E)-[(15S,19S)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/C12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12)c1ccccc1 |
| InChI | InChI=1S/C32H23N3O3/c36-29(20-11-3-1-4-12-20)34-33-19-32-24-17-9-7-15-22(24)26(23-16-8-10-18-25(23)32)27-28(32)31(38)35(30(27)37)21-13-5-2-6-14-21/h1-19,26-28H,(H,34,36)/b33-19+/t26?,27-,28+,32?/m0/s1 |
| InChIKey | PWHPHVUZXVNBGR-RMGXVABMSA-N |
| XLogP | 4.65 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|