C37H27N3O3 — CID 126226272
N-[(Z)-[(15S,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-naphthalen-1-ylacetamide (PubChem CID 126226272) has the molecular formula C37H27N3O3 and a molecular weight of 561.64 g/mol. Its IUPAC name is N-[(Z)-[(15S,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-naphthalen-1-ylacetamide.
| Compound Name | N-[(Z)-[(15S,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 126226272 |
| Molecular Formula | C37H27N3O3 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | N-[(Z)-[(15S,19R)-16,18-dioxo-17-phenyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-naphthalen-1-ylacetamide |
| SMILES | O=C(Cc1cccc2ccccc12)N/N=C\C12c3ccccc3C(c3ccccc31)[C@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C37H27N3O3/c41-31(21-24-13-10-12-23-11-4-5-16-26(23)24)39-38-22-37-29-19-8-6-17-27(29)32(28-18-7-9-20-30(28)37)33-34(37)36(43)40(35(33)42)25-14-2-1-3-15-25/h1-20,22,32-34H,21H2,(H,39,41)/b38-22-/t32?,33-,34-,37?/m1/s1 |
| InChIKey | UBASHHUJYNTSHW-FKVHYWESSA-N |
| XLogP | 5.74 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|