C35H29N3O4 — CID 124558652
2-(4-methoxyphenyl)-N-[(Z)-[(15R,19S)-17-(4-methylphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide (PubChem CID 124558652) has the molecular formula C35H29N3O4 and a molecular weight of 555.63 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[(Z)-[(15R,19S)-17-(4-methylphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[(Z)-[(15R,19S)-17-(4-methylphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124558652 |
| Molecular Formula | C35H29N3O4 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[(Z)-[(15R,19S)-17-(4-methylphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide |
| SMILES | COc1ccc(CC(=O)N/N=C\C23c4ccccc4C(c4ccccc42)[C@@H]2C(=O)N(c4ccc(C)cc4)C(=O)[C@H]23)cc1 |
| InChI | InChI=1S/C35H29N3O4/c1-21-11-15-23(16-12-21)38-33(40)31-30-25-7-3-5-9-27(25)35(32(31)34(38)41,28-10-6-4-8-26(28)30)20-36-37-29(39)19-22-13-17-24(42-2)18-14-22/h3-18,20,30-32H,19H2,1-2H3,(H,37,39)/b36-20-/t30?,31-,32-,35?/m0/s1 |
| InChIKey | RPBKYNVNBHIBIQ-QTGDKTRHSA-N |
| XLogP | 4.90 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|