C34H26ClN3O4 — CID 124528461
2-(4-chlorophenyl)-N-[(Z)-[(15S,19R)-17-(2-methoxyphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide (PubChem CID 124528461) has the molecular formula C34H26ClN3O4 and a molecular weight of 576.05 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(Z)-[(15S,19R)-17-(2-methoxyphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[(Z)-[(15S,19R)-17-(2-methoxyphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124528461 |
| Molecular Formula | C34H26ClN3O4 |
| Molecular Weight | 576.05 g/mol |
| Exact Mass | 575.16 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(Z)-[(15S,19R)-17-(2-methoxyphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide |
| SMILES | COc1ccccc1N1C(=O)[C@@H]2C3c4ccccc4C(/C=N\NC(=O)Cc4ccc(Cl)cc4)(c4ccccc43)[C@H]2C1=O |
| InChI | InChI=1S/C34H26ClN3O4/c1-42-27-13-7-6-12-26(27)38-32(40)30-29-22-8-2-4-10-24(22)34(31(30)33(38)41,25-11-5-3-9-23(25)29)19-36-37-28(39)18-20-14-16-21(35)17-15-20/h2-17,19,29-31H,18H2,1H3,(H,37,39)/b36-19-/t29?,30-,31-,34?/m1/s1 |
| InChIKey | GNPQUIKKVFFHKK-OVEDPRDUSA-N |
| XLogP | 5.24 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.05 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|