C34H26N4O6 — CID 124558556
2-(4-methoxyphenyl)-N-[(Z)-[(15S,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide (PubChem CID 124558556) has the molecular formula C34H26N4O6 and a molecular weight of 586.60 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-N-[(Z)-[(15S,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide.
| Compound Name | 2-(4-methoxyphenyl)-N-[(Z)-[(15S,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 124558556 |
| Molecular Formula | C34H26N4O6 |
| Molecular Weight | 586.60 g/mol |
| Exact Mass | 586.19 |
| IUPAC Name | 2-(4-methoxyphenyl)-N-[(Z)-[(15S,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide |
| SMILES | COc1ccc(CC(=O)N/N=C\C23c4ccccc4C(c4ccccc42)[C@H]2C(=O)N(c4ccccc4[N+](=O)[O-])C(=O)[C@@H]23)cc1 |
| InChI | InChI=1S/C34H26N4O6/c1-44-21-16-14-20(15-17-21)18-28(39)36-35-19-34-24-10-4-2-8-22(24)29(23-9-3-5-11-25(23)34)30-31(34)33(41)37(32(30)40)26-12-6-7-13-27(26)38(42)43/h2-17,19,29-31H,18H2,1H3,(H,36,39)/b35-19-/t29?,30-,31-,34?/m1/s1 |
| InChIKey | ZOBUFSCIFFVOAA-USIKZRCBSA-N |
| XLogP | 4.50 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|