C37H26N4O5 — CID 126185852
2-naphthalen-1-yl-N-[(Z)-[(15R,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide (PubChem CID 126185852) has the molecular formula C37H26N4O5 and a molecular weight of 606.64 g/mol. Its IUPAC name is 2-naphthalen-1-yl-N-[(Z)-[(15R,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide.
| Compound Name | 2-naphthalen-1-yl-N-[(Z)-[(15R,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 126185852 |
| Molecular Formula | C37H26N4O5 |
| Molecular Weight | 606.64 g/mol |
| Exact Mass | 606.19 |
| IUPAC Name | 2-naphthalen-1-yl-N-[(Z)-[(15R,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]acetamide |
| SMILES | O=C(Cc1cccc2ccccc12)N/N=C\C12c3ccccc3C(c3ccccc31)[C@H]1C(=O)N(c3ccccc3[N+](=O)[O-])C(=O)[C@H]12 |
| InChI | InChI=1S/C37H26N4O5/c42-31(20-23-12-9-11-22-10-1-2-13-24(22)23)39-38-21-37-27-16-5-3-14-25(27)32(26-15-4-6-17-28(26)37)33-34(37)36(44)40(35(33)43)29-18-7-8-19-30(29)41(45)46/h1-19,21,32-34H,20H2,(H,39,42)/b38-21-/t32?,33-,34+,37?/m1/s1 |
| InChIKey | QJKPZVLRMHKGCV-LDFVFLNSSA-N |
| XLogP | 5.64 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.64 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|