C32H22N4O6 — CID 126233851
2-hydroxy-N-[(Z)-[(15R,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide (PubChem CID 126233851) has the molecular formula C32H22N4O6 and a molecular weight of 558.55 g/mol. Its IUPAC name is 2-hydroxy-N-[(Z)-[(15R,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide.
| Compound Name | 2-hydroxy-N-[(Z)-[(15R,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126233851 |
| Molecular Formula | C32H22N4O6 |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.15 |
| IUPAC Name | 2-hydroxy-N-[(Z)-[(15R,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\C12c3ccccc3C(c3ccccc31)[C@H]1C(=O)N(c3ccccc3[N+](=O)[O-])C(=O)[C@H]12)c1ccccc1O |
| InChI | InChI=1S/C32H22N4O6/c37-25-16-8-3-11-20(25)29(38)34-33-17-32-21-12-4-1-9-18(21)26(19-10-2-5-13-22(19)32)27-28(32)31(40)35(30(27)39)23-14-6-7-15-24(23)36(41)42/h1-17,26-28,37H,(H,34,38)/b33-17-/t26?,27-,28+,32?/m1/s1 |
| InChIKey | ZYTGBPPATRXBEI-ZRIVCTAVSA-N |
| XLogP | 4.27 |
| TPSA | 142.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|