C32H20Cl2N4O6 — CID 126061246
N-[(Z)-[(15R,19S)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-hydroxy-5-nitrobenzamide (PubChem CID 126061246) has the molecular formula C32H20Cl2N4O6 and a molecular weight of 627.44 g/mol. Its IUPAC name is N-[(Z)-[(15R,19S)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-hydroxy-5-nitrobenzamide.
| Compound Name | N-[(Z)-[(15R,19S)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-hydroxy-5-nitrobenzamide |
|---|---|
| PubChem CID | 126061246 |
| Molecular Formula | C32H20Cl2N4O6 |
| Molecular Weight | 627.44 g/mol |
| Exact Mass | 626.08 |
| IUPAC Name | N-[(Z)-[(15R,19S)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-hydroxy-5-nitrobenzamide |
| SMILES | O=C(N/N=C\C12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)N(c3ccc(Cl)cc3Cl)C(=O)[C@H]12)c1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C32H20Cl2N4O6/c33-16-9-11-24(23(34)13-16)37-30(41)27-26-18-5-1-3-7-21(18)32(28(27)31(37)42,22-8-4-2-6-19(22)26)15-35-36-29(40)20-14-17(38(43)44)10-12-25(20)39/h1-15,26-28,39H,(H,36,40)/b35-15-/t26?,27-,28-,32?/m0/s1 |
| InChIKey | GXIZMKXPSCZUFT-GCPRFGKESA-N |
| XLogP | 5.57 |
| TPSA | 142.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|