C32H20Cl2N4O5 — CID 126035881
2,4-dichloro-N-[(Z)-[(15R,19R)-17-(4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide (PubChem CID 126035881) has the molecular formula C32H20Cl2N4O5 and a molecular weight of 611.44 g/mol. Its IUPAC name is 2,4-dichloro-N-[(Z)-[(15R,19R)-17-(4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide.
| Compound Name | 2,4-dichloro-N-[(Z)-[(15R,19R)-17-(4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126035881 |
| Molecular Formula | C32H20Cl2N4O5 |
| Molecular Weight | 611.44 g/mol |
| Exact Mass | 610.08 |
| IUPAC Name | 2,4-dichloro-N-[(Z)-[(15R,19R)-17-(4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C\C12c3ccccc3C(c3ccccc31)[C@H]1C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)[C@H]12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C32H20Cl2N4O5/c33-17-9-14-22(25(34)15-17)29(39)36-35-16-32-23-7-3-1-5-20(23)26(21-6-2-4-8-24(21)32)27-28(32)31(41)37(30(27)40)18-10-12-19(13-11-18)38(42)43/h1-16,26-28H,(H,36,39)/b35-16-/t26?,27-,28+,32?/m1/s1 |
| InChIKey | AYVXXWYPLDQEOX-RQDBVZEMSA-N |
| XLogP | 5.87 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.44 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|