C32H21BrN4O6 — CID 21370774
5-bromo-2-hydroxy-N-[(E)-[17-(4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide (PubChem CID 21370774) has the molecular formula C32H21BrN4O6 and a molecular weight of 637.45 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-N-[(E)-[17-(4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide.
| Compound Name | 5-bromo-2-hydroxy-N-[(E)-[17-(4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 21370774 |
| Molecular Formula | C32H21BrN4O6 |
| Molecular Weight | 637.45 g/mol |
| Exact Mass | 636.06 |
| IUPAC Name | 5-bromo-2-hydroxy-N-[(E)-[17-(4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide |
| SMILES | O=C(N/N=C/C12c3ccccc3C(c3ccccc31)C1C(=O)N(c3ccc([N+](=O)[O-])cc3)C(=O)C12)c1cc(Br)ccc1O |
| InChI | InChI=1S/C32H21BrN4O6/c33-17-9-14-25(38)22(15-17)29(39)35-34-16-32-23-7-3-1-5-20(23)26(21-6-2-4-8-24(21)32)27-28(32)31(41)36(30(27)40)18-10-12-19(13-11-18)37(42)43/h1-16,26-28,38H,(H,35,39)/b34-16+ |
| InChIKey | VEDNUHHDPBDQNR-AABVJFSESA-N |
| XLogP | 5.03 |
| TPSA | 142.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.45 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|