C30H19Cl2N3O4 — CID 124558668
N-[(Z)-[(15S,19R)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]furan-2-carboxamide (PubChem CID 124558668) has the molecular formula C30H19Cl2N3O4 and a molecular weight of 556.41 g/mol. Its IUPAC name is N-[(Z)-[(15S,19R)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]furan-2-carboxamide.
| Compound Name | N-[(Z)-[(15S,19R)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 124558668 |
| Molecular Formula | C30H19Cl2N3O4 |
| Molecular Weight | 556.41 g/mol |
| Exact Mass | 555.08 |
| IUPAC Name | N-[(Z)-[(15S,19R)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]furan-2-carboxamide |
| SMILES | O=C(N/N=C\C12c3ccccc3C(c3ccccc31)[C@H]1C(=O)N(c3ccc(Cl)cc3Cl)C(=O)[C@@H]12)c1ccco1 |
| InChI | InChI=1S/C30H19Cl2N3O4/c31-16-11-12-22(21(32)14-16)35-28(37)25-24-17-6-1-3-8-19(17)30(26(25)29(35)38,20-9-4-2-7-18(20)24)15-33-34-27(36)23-10-5-13-39-23/h1-15,24-26H,(H,34,36)/b33-15-/t24?,25-,26-,30?/m1/s1 |
| InChIKey | SEVVHESZHCMJQG-BHXJHKQESA-N |
| XLogP | 5.55 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.41 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|