C33H23ClN4O6 — CID 126049386
N-[(Z)-[(15R,19S)-17-(4-chloro-2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-methoxybenzamide (PubChem CID 126049386) has the molecular formula C33H23ClN4O6 and a molecular weight of 607.02 g/mol. Its IUPAC name is N-[(Z)-[(15R,19S)-17-(4-chloro-2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-methoxybenzamide.
| Compound Name | N-[(Z)-[(15R,19S)-17-(4-chloro-2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 126049386 |
| Molecular Formula | C33H23ClN4O6 |
| Molecular Weight | 607.02 g/mol |
| Exact Mass | 606.13 |
| IUPAC Name | N-[(Z)-[(15R,19S)-17-(4-chloro-2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N/N=C\C23c4ccccc4C(c4ccccc42)[C@@H]2C(=O)N(c4ccc(Cl)cc4[N+](=O)[O-])C(=O)[C@H]23)c1 |
| InChI | InChI=1S/C33H23ClN4O6/c1-44-20-8-6-7-18(15-20)30(39)36-35-17-33-23-11-4-2-9-21(23)27(22-10-3-5-12-24(22)33)28-29(33)32(41)37(31(28)40)25-14-13-19(34)16-26(25)38(42)43/h2-17,27-29H,1H3,(H,36,39)/b35-17-/t27?,28-,29-,33?/m0/s1 |
| InChIKey | LXAGOJIVXUUDSP-XJMVVKOSSA-N |
| XLogP | 5.22 |
| TPSA | 131.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.02 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|