C34H27N3O4 — CID 126229501
N-[(Z)-[(15R,19S)-17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-methoxybenzamide (PubChem CID 126229501) has the molecular formula C34H27N3O4 and a molecular weight of 541.61 g/mol. Its IUPAC name is N-[(Z)-[(15R,19S)-17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-methoxybenzamide.
| Compound Name | N-[(Z)-[(15R,19S)-17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-methoxybenzamide |
|---|---|
| PubChem CID | 126229501 |
| Molecular Formula | C34H27N3O4 |
| Molecular Weight | 541.61 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | N-[(Z)-[(15R,19S)-17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N/N=C\C23c4ccccc4C(c4ccccc42)[C@@H]2C(=O)N(Cc4ccccc4)C(=O)[C@H]23)c1 |
| InChI | InChI=1S/C34H27N3O4/c1-41-23-13-9-12-22(18-23)31(38)36-35-20-34-26-16-7-5-14-24(26)28(25-15-6-8-17-27(25)34)29-30(34)33(40)37(32(29)39)19-21-10-3-2-4-11-21/h2-18,20,28-30H,19H2,1H3,(H,36,38)/b35-20-/t28?,29-,30-,34?/m0/s1 |
| InChIKey | GUDZQTLRXAUWCL-WQJLQGQTSA-N |
| XLogP | 4.66 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|