C32H29N3O5 — CID 21370303
N-[(E)-(17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl)methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide (PubChem CID 21370303) has the molecular formula C32H29N3O5 and a molecular weight of 535.60 g/mol. Its IUPAC name is N-[(E)-(17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl)methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide.
| Compound Name | N-[(E)-(17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl)methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 21370303 |
| Molecular Formula | C32H29N3O5 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.21 |
| IUPAC Name | N-[(E)-(17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl)methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
| SMILES | CC1(CC(=O)N/N=C/C23c4ccccc4C(c4ccccc42)C2C(=O)N(Cc4ccccc4)C(=O)C23)OCCO1 |
| InChI | InChI=1S/C32H29N3O5/c1-31(39-15-16-40-31)17-25(36)34-33-19-32-23-13-7-5-11-21(23)26(22-12-6-8-14-24(22)32)27-28(32)30(38)35(29(27)37)18-20-9-3-2-4-10-20/h2-14,19,26-28H,15-18H2,1H3,(H,34,36)/b33-19+ |
| InChIKey | HLHKRCDLTNTBPZ-HNSNBQBZSA-N |
| XLogP | 3.49 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|