C32H24N4O3 — CID 41314795
N-[(Z)-[(15S,19S)-17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]pyridine-3-carboxamide (PubChem CID 41314795) has the molecular formula C32H24N4O3 and a molecular weight of 512.57 g/mol. Its IUPAC name is N-[(Z)-[(15S,19S)-17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]pyridine-3-carboxamide.
| Compound Name | N-[(Z)-[(15S,19S)-17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 41314795 |
| Molecular Formula | C32H24N4O3 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | N-[(Z)-[(15S,19S)-17-benzyl-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]pyridine-3-carboxamide |
| SMILES | O=C(N/N=C\C12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)N(Cc3ccccc3)C(=O)[C@@H]12)c1cccnc1 |
| InChI | InChI=1S/C32H24N4O3/c37-29(21-11-8-16-33-17-21)35-34-19-32-24-14-6-4-12-22(24)26(23-13-5-7-15-25(23)32)27-28(32)31(39)36(30(27)38)18-20-9-2-1-3-10-20/h1-17,19,26-28H,18H2,(H,35,37)/b34-19-/t26?,27-,28+,32?/m0/s1 |
| InChIKey | KDXBZCJZESOOOY-OJAFPKBGSA-N |
| XLogP | 4.04 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|