C32H26N4O5 — CID 124559051
N-[(Z)-[(15S,19R)-17-(2-cyanophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide (PubChem CID 124559051) has the molecular formula C32H26N4O5 and a molecular weight of 546.58 g/mol. Its IUPAC name is N-[(Z)-[(15S,19R)-17-(2-cyanophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide.
| Compound Name | N-[(Z)-[(15S,19R)-17-(2-cyanophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
|---|---|
| PubChem CID | 124559051 |
| Molecular Formula | C32H26N4O5 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | N-[(Z)-[(15S,19R)-17-(2-cyanophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(2-methyl-1,3-dioxolan-2-yl)acetamide |
| SMILES | CC1(CC(=O)N/N=C\C23c4ccccc4C(c4ccccc42)[C@H]2C(=O)N(c4ccccc4C#N)C(=O)[C@@H]23)OCCO1 |
| InChI | InChI=1S/C32H26N4O5/c1-31(40-14-15-41-31)16-25(37)35-34-18-32-22-11-5-3-9-20(22)26(21-10-4-6-12-23(21)32)27-28(32)30(39)36(29(27)38)24-13-7-2-8-19(24)17-33/h2-13,18,26-28H,14-16H2,1H3,(H,35,37)/b34-18-/t26?,27-,28-,32?/m1/s1 |
| InChIKey | OWXYVRZKKBTFGW-BRUHHPIBSA-N |
| XLogP | 3.36 |
| TPSA | 121.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|