C33H21N5O5 — CID 126184928
N-[(Z)-[(15R,19S)-17-(2-cyanophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-nitrobenzamide (PubChem CID 126184928) has the molecular formula C33H21N5O5 and a molecular weight of 567.56 g/mol. Its IUPAC name is N-[(Z)-[(15R,19S)-17-(2-cyanophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(Z)-[(15R,19S)-17-(2-cyanophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126184928 |
| Molecular Formula | C33H21N5O5 |
| Molecular Weight | 567.56 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | N-[(Z)-[(15R,19S)-17-(2-cyanophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-nitrobenzamide |
| SMILES | N#Cc1ccccc1N1C(=O)[C@@H]2[C@@H](C1=O)C1c3ccccc3C2(/C=N\NC(=O)c2cccc([N+](=O)[O-])c2)c2ccccc21 |
| InChI | InChI=1S/C33H21N5O5/c34-17-20-8-1-6-15-26(20)37-31(40)28-27-22-11-2-4-13-24(22)33(29(28)32(37)41,25-14-5-3-12-23(25)27)18-35-36-30(39)19-9-7-10-21(16-19)38(42)43/h1-16,18,27-29H,(H,36,39)/b35-18-/t27?,28-,29-,33?/m0/s1 |
| InChIKey | LVGWFYCDFHMISQ-ZAROQNEASA-N |
| XLogP | 4.43 |
| TPSA | 145.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|