C33H23N5O8 — CID 126187986
N-[(Z)-[(15S,19S)-17-(2-methoxy-4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-nitrobenzamide (PubChem CID 126187986) has the molecular formula C33H23N5O8 and a molecular weight of 617.57 g/mol. Its IUPAC name is N-[(Z)-[(15S,19S)-17-(2-methoxy-4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-nitrobenzamide.
| Compound Name | N-[(Z)-[(15S,19S)-17-(2-methoxy-4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-nitrobenzamide |
|---|---|
| PubChem CID | 126187986 |
| Molecular Formula | C33H23N5O8 |
| Molecular Weight | 617.57 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | N-[(Z)-[(15S,19S)-17-(2-methoxy-4-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-3-nitrobenzamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1N1C(=O)[C@H]2C3c4ccccc4C(/C=N\NC(=O)c4cccc([N+](=O)[O-])c4)(c4ccccc43)[C@H]2C1=O |
| InChI | InChI=1S/C33H23N5O8/c1-46-26-16-20(38(44)45)13-14-25(26)36-31(40)28-27-21-9-2-4-11-23(21)33(29(28)32(36)41,24-12-5-3-10-22(24)27)17-34-35-30(39)18-7-6-8-19(15-18)37(42)43/h2-17,27-29H,1H3,(H,35,39)/b34-17-/t27?,28-,29+,33?/m0/s1 |
| InChIKey | FIAPYQUEONXSFN-HRNHFPMHSA-N |
| XLogP | 4.48 |
| TPSA | 174.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|