C34H25Cl2N3O4 — CID 124558554
N-[(Z)-[(15R,19R)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(4-methoxyphenyl)acetamide (PubChem CID 124558554) has the molecular formula C34H25Cl2N3O4 and a molecular weight of 610.50 g/mol. Its IUPAC name is N-[(Z)-[(15R,19R)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[(Z)-[(15R,19R)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 124558554 |
| Molecular Formula | C34H25Cl2N3O4 |
| Molecular Weight | 610.50 g/mol |
| Exact Mass | 609.12 |
| IUPAC Name | N-[(Z)-[(15R,19R)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N/N=C\C23c4ccccc4C(c4ccccc42)[C@H]2C(=O)N(c4ccc(Cl)cc4Cl)C(=O)[C@H]23)cc1 |
| InChI | InChI=1S/C34H25Cl2N3O4/c1-43-21-13-10-19(11-14-21)16-28(40)38-37-18-34-24-8-4-2-6-22(24)29(23-7-3-5-9-25(23)34)30-31(34)33(42)39(32(30)41)27-15-12-20(35)17-26(27)36/h2-15,17-18,29-31H,16H2,1H3,(H,38,40)/b37-18-/t29?,30-,31+,34?/m1/s1 |
| InChIKey | YWIZEEOWLIPFBX-LZFUYDBOSA-N |
| XLogP | 5.90 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.50 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|