C33H23Cl2IN4O3 — CID 126230987
N-[(Z)-[(15R,19S)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(4-iodoanilino)acetamide (PubChem CID 126230987) has the molecular formula C33H23Cl2IN4O3 and a molecular weight of 721.38 g/mol. Its IUPAC name is N-[(Z)-[(15R,19S)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(4-iodoanilino)acetamide.
| Compound Name | N-[(Z)-[(15R,19S)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(4-iodoanilino)acetamide |
|---|---|
| PubChem CID | 126230987 |
| Molecular Formula | C33H23Cl2IN4O3 |
| Molecular Weight | 721.38 g/mol |
| Exact Mass | 720.02 |
| IUPAC Name | N-[(Z)-[(15R,19S)-17-(2,4-dichlorophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]-2-(4-iodoanilino)acetamide |
| SMILES | O=C(CNc1ccc(I)cc1)N/N=C\C12c3ccccc3C(c3ccccc31)[C@@H]1C(=O)N(c3ccc(Cl)cc3Cl)C(=O)[C@H]12 |
| InChI | InChI=1S/C33H23Cl2IN4O3/c34-18-9-14-26(25(35)15-18)40-31(42)29-28-21-5-1-3-7-23(21)33(30(29)32(40)43,24-8-4-2-6-22(24)28)17-38-39-27(41)16-37-20-12-10-19(36)11-13-20/h1-15,17,28-30,37H,16H2,(H,39,41)/b38-17-/t28?,29-,30-,33?/m0/s1 |
| InChIKey | MUAGJWXROVVBFT-SRAZEJDSSA-N |
| XLogP | 6.36 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.38 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|