C33H24ClN3O3 — CID 126233422
4-chloro-N-[(Z)-[(15S,19S)-17-(4-methylphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide (PubChem CID 126233422) has the molecular formula C33H24ClN3O3 and a molecular weight of 546.03 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-[(15S,19S)-17-(4-methylphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(Z)-[(15S,19S)-17-(4-methylphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126233422 |
| Molecular Formula | C33H24ClN3O3 |
| Molecular Weight | 546.03 g/mol |
| Exact Mass | 545.15 |
| IUPAC Name | 4-chloro-N-[(Z)-[(15S,19S)-17-(4-methylphenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]benzamide |
| SMILES | Cc1ccc(N2C(=O)[C@H]3C4c5ccccc5C(/C=N\NC(=O)c5ccc(Cl)cc5)(c5ccccc54)[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C33H24ClN3O3/c1-19-10-16-22(17-11-19)37-31(39)28-27-23-6-2-4-8-25(23)33(29(28)32(37)40,26-9-5-3-7-24(26)27)18-35-36-30(38)20-12-14-21(34)15-13-20/h2-18,27-29H,1H3,(H,36,38)/b35-18-/t27?,28-,29+,33?/m0/s1 |
| InChIKey | UMFPQVVXYJWKHZ-BXAFPDBCSA-N |
| XLogP | 5.62 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.03 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|