C36H24N4O5 — CID 126187687
N-[(Z)-[(15S,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]naphthalene-1-carboxamide (PubChem CID 126187687) has the molecular formula C36H24N4O5 and a molecular weight of 592.61 g/mol. Its IUPAC name is N-[(Z)-[(15S,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]naphthalene-1-carboxamide.
| Compound Name | N-[(Z)-[(15S,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 126187687 |
| Molecular Formula | C36H24N4O5 |
| Molecular Weight | 592.61 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | N-[(Z)-[(15S,19R)-17-(2-nitrophenyl)-16,18-dioxo-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaen-1-yl]methylideneamino]naphthalene-1-carboxamide |
| SMILES | O=C(N/N=C\C12c3ccccc3C(c3ccccc31)[C@H]1C(=O)N(c3ccccc3[N+](=O)[O-])C(=O)[C@@H]12)c1cccc2ccccc12 |
| InChI | InChI=1S/C36H24N4O5/c41-33(23-15-9-11-21-10-1-2-12-22(21)23)38-37-20-36-26-16-5-3-13-24(26)30(25-14-4-6-17-27(25)36)31-32(36)35(43)39(34(31)42)28-18-7-8-19-29(28)40(44)45/h1-20,30-32H,(H,38,41)/b37-20-/t30?,31-,32-,36?/m1/s1 |
| InChIKey | CFRWMLSDNDCHAY-DHMHPQAPSA-N |
| XLogP | 5.71 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|