C31H19Cl2N3O4 — CID 92905812
(15S,19R)-1-[(2,3-dichlorophenyl)iminomethyl]-17-(2-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 92905812) has the molecular formula C31H19Cl2N3O4 and a molecular weight of 568.42 g/mol. Its IUPAC name is (15S,19R)-1-[(2,3-dichlorophenyl)iminomethyl]-17-(2-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19R)-1-[(2,3-dichlorophenyl)iminomethyl]-17-(2-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 92905812 |
| Molecular Formula | C31H19Cl2N3O4 |
| Molecular Weight | 568.42 g/mol |
| Exact Mass | 567.08 |
| IUPAC Name | (15S,19R)-1-[(2,3-dichlorophenyl)iminomethyl]-17-(2-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@@H]2C3c4ccccc4C(/C=N/c4cccc(Cl)c4Cl)(c4ccccc43)[C@H]2C(=O)N1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H19Cl2N3O4/c32-21-12-7-13-22(28(21)33)34-16-31-19-10-3-1-8-17(19)25(18-9-2-4-11-20(18)31)26-27(31)30(38)35(29(26)37)23-14-5-6-15-24(23)36(39)40/h1-16,25-27H/b34-16+/t25?,26-,27-,31?/m1/s1 |
| InChIKey | XCIMKPQIABOVKQ-RSWGBYAASA-N |
| XLogP | 6.85 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.42 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|