C32H22N6O4 — CID 124558905
(15S,19S)-1-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-17-(2-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 124558905) has the molecular formula C32H22N6O4 and a molecular weight of 554.57 g/mol. Its IUPAC name is (15S,19S)-1-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-17-(2-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19S)-1-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-17-(2-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 124558905 |
| Molecular Formula | C32H22N6O4 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | (15S,19S)-1-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-17-(2-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@H]2C3c4ccccc4C(/C=N\Nc4nc5ccccc5[nH]4)(c4ccccc43)[C@H]2C(=O)N1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C32H22N6O4/c39-29-27-26-18-9-1-3-11-20(18)32(21-12-4-2-10-19(21)26,17-33-36-31-34-22-13-5-6-14-23(22)35-31)28(27)30(40)37(29)24-15-7-8-16-25(24)38(41)42/h1-17,26-28H,(H2,34,35,36)/b33-17-/t26?,27-,28+,32?/m0/s1 |
| InChIKey | OASJNUDIBZCXIY-VKAFVGABSA-N |
| XLogP | 5.12 |
| TPSA | 133.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|