C36H25N5O2 — CID 124558851
(15R,19S)-1-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-17-naphthalen-1-yl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 124558851) has the molecular formula C36H25N5O2 and a molecular weight of 559.63 g/mol. Its IUPAC name is (15R,19S)-1-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-17-naphthalen-1-yl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19S)-1-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-17-naphthalen-1-yl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 124558851 |
| Molecular Formula | C36H25N5O2 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | (15R,19S)-1-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-17-naphthalen-1-yl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1cccc3ccccc13)C1c3ccccc3C2(/C=N\Nc2nc3ccccc3[nH]2)c2ccccc21 |
| InChI | InChI=1S/C36H25N5O2/c42-33-31-30-23-13-3-5-15-25(23)36(26-16-6-4-14-24(26)30,20-37-40-35-38-27-17-7-8-18-28(27)39-35)32(31)34(43)41(33)29-19-9-11-21-10-1-2-12-22(21)29/h1-20,30-32H,(H2,38,39,40)/b37-20-/t30?,31-,32-,36?/m0/s1 |
| InChIKey | PWHZIBFTLQWQRZ-YGMIUVOXSA-N |
| XLogP | 6.36 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|