C33H24ClN5O2 — CID 126186988
(15R,19S)-1-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-17-(3-chloro-4-methylphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 126186988) has the molecular formula C33H24ClN5O2 and a molecular weight of 558.04 g/mol. Its IUPAC name is (15R,19S)-1-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-17-(3-chloro-4-methylphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19S)-1-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-17-(3-chloro-4-methylphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 126186988 |
| Molecular Formula | C33H24ClN5O2 |
| Molecular Weight | 558.04 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | (15R,19S)-1-[(Z)-(1H-benzimidazol-2-ylhydrazinylidene)methyl]-17-(3-chloro-4-methylphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)C2c4ccccc4C3(/C=N\Nc3nc4ccccc4[nH]3)c3ccccc32)cc1Cl |
| InChI | InChI=1S/C33H24ClN5O2/c1-18-14-15-19(16-24(18)34)39-30(40)28-27-20-8-2-4-10-22(20)33(29(28)31(39)41,23-11-5-3-9-21(23)27)17-35-38-32-36-25-12-6-7-13-26(25)37-32/h2-17,27-29H,1H3,(H2,36,37,38)/b35-17-/t27?,28-,29-,33?/m0/s1 |
| InChIKey | USVHCAQURCVVNA-XJMVVKOSSA-N |
| XLogP | 6.17 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.04 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|