C32H21ClN4O2S — CID 124558857
(15R,19S)-1-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-17-(2-chlorophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 124558857) has the molecular formula C32H21ClN4O2S and a molecular weight of 561.07 g/mol. Its IUPAC name is (15R,19S)-1-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-17-(2-chlorophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19S)-1-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-17-(2-chlorophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 124558857 |
| Molecular Formula | C32H21ClN4O2S |
| Molecular Weight | 561.07 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | (15R,19S)-1-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-17-(2-chlorophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@@H]2[C@@H](C(=O)N1c1ccccc1Cl)C1c3ccccc3C2(/C=N\Nc2nc3ccccc3s2)c2ccccc21 |
| InChI | InChI=1S/C32H21ClN4O2S/c33-22-13-5-7-15-24(22)37-29(38)27-26-18-9-1-3-11-20(18)32(28(27)30(37)39,21-12-4-2-10-19(21)26)17-34-36-31-35-23-14-6-8-16-25(23)40-31/h1-17,26-28H,(H,35,36)/b34-17-/t26?,27-,28-,32?/m0/s1 |
| InChIKey | XQCFBKMUZLLLQG-HJOZPFKESA-N |
| XLogP | 6.60 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.07 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|