C31H22BrN3O2 — CID 126186216
(15S,19R)-17-(4-bromophenyl)-1-[(Z)-(phenylhydrazinylidene)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 126186216) has the molecular formula C31H22BrN3O2 and a molecular weight of 548.44 g/mol. Its IUPAC name is (15S,19R)-17-(4-bromophenyl)-1-[(Z)-(phenylhydrazinylidene)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19R)-17-(4-bromophenyl)-1-[(Z)-(phenylhydrazinylidene)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 126186216 |
| Molecular Formula | C31H22BrN3O2 |
| Molecular Weight | 548.44 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | (15S,19R)-17-(4-bromophenyl)-1-[(Z)-(phenylhydrazinylidene)methyl]-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@@H]2C3c4ccccc4C(/C=N\Nc4ccccc4)(c4ccccc43)[C@H]2C(=O)N1c1ccc(Br)cc1 |
| InChI | InChI=1S/C31H22BrN3O2/c32-19-14-16-21(17-15-19)35-29(36)27-26-22-10-4-6-12-24(22)31(28(27)30(35)37,25-13-7-5-11-23(25)26)18-33-34-20-8-2-1-3-9-20/h1-18,26-28,34H/b33-18-/t26?,27-,28-,31?/m1/s1 |
| InChIKey | QRUIPDUHKXEXOK-KDKWXFRQSA-N |
| XLogP | 6.10 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.44 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|