C32H21N5O4S — CID 124558541
(15R,19R)-1-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-17-(4-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 124558541) has the molecular formula C32H21N5O4S and a molecular weight of 571.62 g/mol. Its IUPAC name is (15R,19R)-1-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-17-(4-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19R)-1-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-17-(4-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 124558541 |
| Molecular Formula | C32H21N5O4S |
| Molecular Weight | 571.62 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | (15R,19R)-1-[(Z)-(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-17-(4-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@@H]2C3c4ccccc4C(/C=N\Nc4nc5ccccc5s4)(c4ccccc43)[C@@H]2C(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C32H21N5O4S/c38-29-27-26-20-7-1-3-9-22(20)32(23-10-4-2-8-21(23)26,17-33-35-31-34-24-11-5-6-12-25(24)42-31)28(27)30(39)36(29)18-13-15-19(16-14-18)37(40)41/h1-17,26-28H,(H,34,35)/b33-17-/t26?,27-,28+,32?/m1/s1 |
| InChIKey | YRIPRJBLKNGFON-ZRIVCTAVSA-N |
| XLogP | 5.85 |
| TPSA | 117.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.62 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|